About (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride
(3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride (PubChem CID 119053418) has the molecular formula C5H11ClFNO
and a molecular weight of 155.60 g/mol. Its IUPAC name is (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride |
| PubChem CID | 119053418 |
| Molecular Formula | C5H11ClFNO |
| Molecular Weight | 155.60 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride |
| SMILES | CO[C@H]1CNC[C@@H]1F.Cl |
| InChI | InChI=1S/C5H10FNO.ClH/c1-8-5-3-7-2-4(5)6;/h4-5,7H,2-3H2,1H3;1H/t4-,5-;/m0./s1 |
| InChIKey | ZWYUPOATRRHOKQ-FHAQVOQBSA-N |
| XLogP | 0.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.60 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride?
The IUPAC name of (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride (CID 119053418) is (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride.
What is the SMILES notation for (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride?
The canonical SMILES for (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride is CO[C@H]1CNC[C@@H]1F.Cl.
What is the InChIKey of (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride?
The InChIKey is ZWYUPOATRRHOKQ-FHAQVOQBSA-N. The full InChI is InChI=1S/C5H10FNO.ClH/c1-8-5-3-7-2-4(5)6;/h4-5,7H,2-3H2,1H3;1H/t4-,5-;/m0./s1.
What are the key properties of (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride?
(3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride has a molecular weight of 155.60 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-fluoro-4-methoxypyrrolidine;hydrochloride is sourced from PubChem (CID 119053418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).