About 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine
3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine (PubChem CID 119054055) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine |
| PubChem CID | 119054055 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine |
| SMILES | CNc1cccnc1N(C(C)C)C(C)C |
| InChI | InChI=1S/C12H21N3/c1-9(2)15(10(3)4)12-11(13-5)7-6-8-14-12/h6-10,13H,1-5H3 |
| InChIKey | XGFISLIEHZZWLG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine?
The IUPAC name of 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine (CID 119054055) is 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine.
What is the SMILES notation for 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine?
The canonical SMILES for 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine is CNc1cccnc1N(C(C)C)C(C)C.
What is the InChIKey of 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine?
The InChIKey is XGFISLIEHZZWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-9(2)15(10(3)4)12-11(13-5)7-6-8-14-12/h6-10,13H,1-5H3.
What are the key properties of 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine?
3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine has a molecular weight of 207.32 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methyl-2-N,2-N-di(propan-2-yl)pyridine-2,3-diamine is sourced from PubChem (CID 119054055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).