C9H10Cl2N2O2 — CID 119054669
5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide (PubChem CID 119054669) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 119054669 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1cc(Cl)c(Cl)nc1C |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-5-6(9(14)13(2)15-3)4-7(10)8(11)12-5/h4H,1-3H3 |
| InChIKey | AHVPRNSTTGJBCX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|