About 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide
5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide (PubChem CID 119054669) has the molecular formula C9H10Cl2N2O2
and a molecular weight of 249.10 g/mol. Its IUPAC name is 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide |
| PubChem CID | 119054669 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1cc(Cl)c(Cl)nc1C |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-5-6(9(14)13(2)15-3)4-7(10)8(11)12-5/h4H,1-3H3 |
| InChIKey | AHVPRNSTTGJBCX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide?
The IUPAC name of 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide (CID 119054669) is 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide.
What is the SMILES notation for 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide?
The canonical SMILES for 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide is CON(C)C(=O)c1cc(Cl)c(Cl)nc1C.
What is the InChIKey of 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide?
The InChIKey is AHVPRNSTTGJBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N2O2/c1-5-6(9(14)13(2)15-3)4-7(10)8(11)12-5/h4H,1-3H3.
What are the key properties of 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide?
5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide has a molecular weight of 249.10 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-N-methoxy-N,2-dimethylpyridine-3-carboxamide is sourced from PubChem (CID 119054669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).