C15H16ClNO4 — CID 119054850
methyl 2-chloro-6,7-diethoxyquinoline-3-carboxylate (PubChem CID 119054850) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is methyl 2-chloro-6,7-diethoxyquinoline-3-carboxylate.
| Compound Name | methyl 2-chloro-6,7-diethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 119054850 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | methyl 2-chloro-6,7-diethoxyquinoline-3-carboxylate |
| SMILES | CCOc1cc2cc(C(=O)OC)c(Cl)nc2cc1OCC |
| InChI | InChI=1S/C15H16ClNO4/c1-4-20-12-7-9-6-10(15(18)19-3)14(16)17-11(9)8-13(12)21-5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | OHJYQNUOAJLRKT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|