About ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate
ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate (PubChem CID 1190556) has the molecular formula C22H22N2O3
and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate |
| PubChem CID | 1190556 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C)cc(C)cc2c1Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-5-27-22(26)19-12-23-20-14(3)10-13(2)11-18(20)21(19)24-17-8-6-16(7-9-17)15(4)25/h6-12H,5H2,1-4H3,(H,23,24) |
| InChIKey | OAJBHLHKVONAMP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate?
The IUPAC name of ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate (CID 1190556) is ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate.
What is the SMILES notation for ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate?
The canonical SMILES for ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate is CCOC(=O)c1cnc2c(C)cc(C)cc2c1Nc1ccc(C(C)=O)cc1.
What is the InChIKey of ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate?
The InChIKey is OAJBHLHKVONAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3/c1-5-27-22(26)19-12-23-20-14(3)10-13(2)11-18(20)21(19)24-17-8-6-16(7-9-17)15(4)25/h6-12H,5H2,1-4H3,(H,23,24).
What are the key properties of ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate?
ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate has a molecular weight of 362.43 g/mol, XLogP of 4.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-acetylanilino)-6,8-dimethylquinoline-3-carboxylate is sourced from PubChem (CID 1190556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).