C17H24N2O3S — CID 119055603
6-(azepan-1-ylsulfonyl)-1-ethyl-3,4-dihydroquinolin-2-one (PubChem CID 119055603) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-1-ethyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(azepan-1-ylsulfonyl)-1-ethyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 119055603 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-1-ethyl-3,4-dihydroquinolin-2-one |
| SMILES | CCN1C(=O)CCc2cc(S(=O)(=O)N3CCCCCC3)ccc21 |
| InChI | InChI=1S/C17H24N2O3S/c1-2-19-16-9-8-15(13-14(16)7-10-17(19)20)23(21,22)18-11-5-3-4-6-12-18/h8-9,13H,2-7,10-12H2,1H3 |
| InChIKey | RBJOEQNKEYVPFC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |