C12H12ClF3N6O — CID 119056066
4-chloro-1,5-dimethyl-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrazole-3-carboxamide (PubChem CID 119056066) has the molecular formula C12H12ClF3N6O and a molecular weight of 348.72 g/mol. Its IUPAC name is 4-chloro-1,5-dimethyl-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1,5-dimethyl-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119056066 |
| Molecular Formula | C12H12ClF3N6O |
| Molecular Weight | 348.72 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-chloro-1,5-dimethyl-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrazole-3-carboxamide |
| SMILES | Cc1c(Cl)c(C(=O)N/N=C/c2ccn(CC(F)(F)F)n2)nn1C |
| InChI | InChI=1S/C12H12ClF3N6O/c1-7-9(13)10(20-21(7)2)11(23)18-17-5-8-3-4-22(19-8)6-12(14,15)16/h3-5H,6H2,1-2H3,(H,18,23)/b17-5+ |
| InChIKey | LLXXNJFRPVIDTQ-YAXRCOADSA-N |
| XLogP | 1.90 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.72 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|