C16H14F6N8 — CID 119056186
4-(1,3-dimethylpyrazol-4-yl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 119056186) has the molecular formula C16H14F6N8 and a molecular weight of 432.33 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 119056186 |
| Molecular Formula | C16H14F6N8 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1nn(C)cc1-c1cc(C(F)(F)F)nc(N/N=C/c2ccn(CC(F)(F)F)n2)n1 |
| InChI | InChI=1S/C16H14F6N8/c1-9-11(7-29(2)27-9)12-5-13(16(20,21)22)25-14(24-12)26-23-6-10-3-4-30(28-10)8-15(17,18)19/h3-7H,8H2,1-2H3,(H,24,25,26)/b23-6+ |
| InChIKey | SCZKYMNJDKIUQY-TXNBCWFRSA-N |
| XLogP | 3.41 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|