C17H12F6N6 — CID 119056193
4-(difluoromethyl)-6-(4-fluorophenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrimidin-2-amine (PubChem CID 119056193) has the molecular formula C17H12F6N6 and a molecular weight of 414.31 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-(4-fluorophenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrimidin-2-amine.
| Compound Name | 4-(difluoromethyl)-6-(4-fluorophenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 119056193 |
| Molecular Formula | C17H12F6N6 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 4-(difluoromethyl)-6-(4-fluorophenyl)-N-[(E)-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methylideneamino]pyrimidin-2-amine |
| SMILES | Fc1ccc(-c2cc(C(F)F)nc(N/N=C/c3ccn(CC(F)(F)F)n3)n2)cc1 |
| InChI | InChI=1S/C17H12F6N6/c18-11-3-1-10(2-4-11)13-7-14(15(19)20)26-16(25-13)27-24-8-12-5-6-29(28-12)9-17(21,22)23/h1-8,15H,9H2,(H,25,26,27)/b24-8+ |
| InChIKey | BWFFHQBYFLJDNC-KTZMUZOWSA-N |
| XLogP | 4.43 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|