About tert-butyl 4-oxo-5-phenylpentanoate
tert-butyl 4-oxo-5-phenylpentanoate (PubChem CID 119056831) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is tert-butyl 4-oxo-5-phenylpentanoate.
Molecular Properties
| Compound Name | tert-butyl 4-oxo-5-phenylpentanoate |
| PubChem CID | 119056831 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | tert-butyl 4-oxo-5-phenylpentanoate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-15(2,3)18-14(17)10-9-13(16)11-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3 |
| InChIKey | GSNPCIQEMIVIJG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-oxo-5-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-oxo-5-phenylpentanoate?
The IUPAC name of tert-butyl 4-oxo-5-phenylpentanoate (CID 119056831) is tert-butyl 4-oxo-5-phenylpentanoate.
What is the SMILES notation for tert-butyl 4-oxo-5-phenylpentanoate?
The canonical SMILES for tert-butyl 4-oxo-5-phenylpentanoate is CC(C)(C)OC(=O)CCC(=O)Cc1ccccc1.
What is the InChIKey of tert-butyl 4-oxo-5-phenylpentanoate?
The InChIKey is GSNPCIQEMIVIJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-15(2,3)18-14(17)10-9-13(16)11-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3.
What are the key properties of tert-butyl 4-oxo-5-phenylpentanoate?
tert-butyl 4-oxo-5-phenylpentanoate has a molecular weight of 248.32 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-oxo-5-phenylpentanoate is sourced from PubChem (CID 119056831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).