About [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride
[1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride (PubChem CID 119056959) has the molecular formula C8H17Cl2F3N2
and a molecular weight of 269.14 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride |
| PubChem CID | 119056959 |
| Molecular Formula | C8H17Cl2F3N2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C8H15F3N2.2ClH/c9-8(10,11)6-13-3-1-2-7(4-12)5-13;;/h7H,1-6,12H2;2*1H |
| InChIKey | YUACIXJZQCARNC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride?
The IUPAC name of [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride (CID 119056959) is [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride.
What is the SMILES notation for [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride?
The canonical SMILES for [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride is Cl.Cl.NCC1CCCN(CC(F)(F)F)C1.
What is the InChIKey of [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride?
The InChIKey is YUACIXJZQCARNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2.2ClH/c9-8(10,11)6-13-3-1-2-7(4-12)5-13;;/h7H,1-6,12H2;2*1H.
What are the key properties of [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride?
[1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride has a molecular weight of 269.14 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride is sourced from PubChem (CID 119056959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).