C10H14ClNO2S — CID 119057095
6-methylsulfonyl-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 119057095) has the molecular formula C10H14ClNO2S and a molecular weight of 247.75 g/mol. Its IUPAC name is 6-methylsulfonyl-1,2,3,4-tetrahydroquinoline;hydrochloride.
| Compound Name | 6-methylsulfonyl-1,2,3,4-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 119057095 |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 6-methylsulfonyl-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCCN2.Cl |
| InChI | InChI=1S/C10H13NO2S.ClH/c1-14(12,13)9-4-5-10-8(7-9)3-2-6-11-10;/h4-5,7,11H,2-3,6H2,1H3;1H |
| InChIKey | MEHOLLNKUOYWKI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |