About 2-cyclopropylazetidine;hydrochloride
2-cyclopropylazetidine;hydrochloride (PubChem CID 119057103) has the molecular formula C6H12ClN
and a molecular weight of 133.62 g/mol. Its IUPAC name is 2-cyclopropylazetidine;hydrochloride.
Molecular Properties
| Compound Name | 2-cyclopropylazetidine;hydrochloride |
| PubChem CID | 119057103 |
| Molecular Formula | C6H12ClN |
| Molecular Weight | 133.62 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 2-cyclopropylazetidine;hydrochloride |
| SMILES | C1CC(C2CC2)N1.Cl |
| InChI | InChI=1S/C6H11N.ClH/c1-2-5(1)6-3-4-7-6;/h5-7H,1-4H2;1H |
| InChIKey | WHIVVDXVBFIWPI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.62 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropylazetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylazetidine;hydrochloride?
The IUPAC name of 2-cyclopropylazetidine;hydrochloride (CID 119057103) is 2-cyclopropylazetidine;hydrochloride.
What is the SMILES notation for 2-cyclopropylazetidine;hydrochloride?
The canonical SMILES for 2-cyclopropylazetidine;hydrochloride is C1CC(C2CC2)N1.Cl.
What is the InChIKey of 2-cyclopropylazetidine;hydrochloride?
The InChIKey is WHIVVDXVBFIWPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.ClH/c1-2-5(1)6-3-4-7-6;/h5-7H,1-4H2;1H.
What are the key properties of 2-cyclopropylazetidine;hydrochloride?
2-cyclopropylazetidine;hydrochloride has a molecular weight of 133.62 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylazetidine;hydrochloride is sourced from PubChem (CID 119057103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).