About 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride
1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride (PubChem CID 119057105) has the molecular formula C11H16Cl2F2N2
and a molecular weight of 285.16 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride.
Molecular Properties
| Compound Name | 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride |
| PubChem CID | 119057105 |
| Molecular Formula | C11H16Cl2F2N2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride |
| SMILES | Cl.Cl.Fc1cccc(N2CCCNCC2)c1F |
| InChI | InChI=1S/C11H14F2N2.2ClH/c12-9-3-1-4-10(11(9)13)15-7-2-5-14-6-8-15;;/h1,3-4,14H,2,5-8H2;2*1H |
| InChIKey | DPXWOAINZSADHO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride?
The IUPAC name of 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride (CID 119057105) is 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride.
What is the SMILES notation for 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride?
The canonical SMILES for 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride is Cl.Cl.Fc1cccc(N2CCCNCC2)c1F.
What is the InChIKey of 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride?
The InChIKey is DPXWOAINZSADHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2.2ClH/c12-9-3-1-4-10(11(9)13)15-7-2-5-14-6-8-15;;/h1,3-4,14H,2,5-8H2;2*1H.
What are the key properties of 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride?
1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride has a molecular weight of 285.16 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride is sourced from PubChem (CID 119057105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).