C25H37N5O9 — CID 119057271
(4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[(2S)-1-hydroxy-3-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 119057271) has the molecular formula C25H37N5O9 and a molecular weight of 551.60 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[(2S)-1-hydroxy-3-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[(2S)-1-hydroxy-3-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 119057271 |
| Molecular Formula | C25H37N5O9 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-[[(2S)-1-hydroxy-3-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C=O)CO |
| InChI | InChI=1S/C25H37N5O9/c1-13(2)21(30-22(36)14(3)26)25(39)29-19(10-15-4-6-17(33)7-5-15)24(38)28-18(8-9-20(34)35)23(37)27-16(11-31)12-32/h4-7,11,13-14,16,18-19,21,32-33H,8-10,12,26H2,1-3H3,(H,27,37)(H,28,38)(H,29,39)(H,30,36)(H,34,35)/t14-,16+,18-,19-,21-/m0/s1 |
| InChIKey | QFZSINYHYNFWRB-NSQMUFKYSA-N |
| XLogP | -2.07 |
| TPSA | 237.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|