C17H27N3O3 — CID 119058857
4-[2-(2-hydroxyethoxy)ethyl]-N-[(3-methylphenyl)methyl]piperazine-1-carboxamide (PubChem CID 119058857) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethyl]-N-[(3-methylphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethyl]-N-[(3-methylphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 119058857 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethyl]-N-[(3-methylphenyl)methyl]piperazine-1-carboxamide |
| SMILES | Cc1cccc(CNC(=O)N2CCN(CCOCCO)CC2)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-15-3-2-4-16(13-15)14-18-17(22)20-7-5-19(6-8-20)9-11-23-12-10-21/h2-4,13,21H,5-12,14H2,1H3,(H,18,22) |
| InChIKey | NSLMZPLQIKXKCH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|