C23H38N2O3+2 — CID 11905908
(1S,8aR)-1-cyclohexyl-2-[(2,4,5-trimethoxyphenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium (PubChem CID 11905908) has the molecular formula C23H38N2O3+2 and a molecular weight of 390.57 g/mol. Its IUPAC name is (1S,8aR)-1-cyclohexyl-2-[(2,4,5-trimethoxyphenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium.
| Compound Name | (1S,8aR)-1-cyclohexyl-2-[(2,4,5-trimethoxyphenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium |
|---|---|
| PubChem CID | 11905908 |
| Molecular Formula | C23H38N2O3+2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (1S,8aR)-1-cyclohexyl-2-[(2,4,5-trimethoxyphenyl)methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium |
| SMILES | COc1cc(OC)c(OC)cc1C[NH+]1CC[NH+]2CCC[C@@H]2[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C23H36N2O3/c1-26-20-15-22(28-3)21(27-2)14-18(20)16-25-13-12-24-11-7-10-19(24)23(25)17-8-5-4-6-9-17/h14-15,17,19,23H,4-13,16H2,1-3H3/p+2/t19-,23+/m1/s1 |
| InChIKey | DWGVCDGPCJUNBN-XXBNENTESA-P |
| XLogP | 1.11 |
| TPSA | 36.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |