C24H32N2 — CID 11905912
(1S,8aR)-1-cyclohexyl-2-(naphthalen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 11905912) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (1S,8aR)-1-cyclohexyl-2-(naphthalen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S,8aR)-1-cyclohexyl-2-(naphthalen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 11905912 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (1S,8aR)-1-cyclohexyl-2-(naphthalen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | c1ccc2cc(CN3CCN4CCC[C@@H]4[C@@H]3C3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C24H32N2/c1-2-8-21(9-3-1)24-23-11-6-14-25(23)15-16-26(24)18-19-12-13-20-7-4-5-10-22(20)17-19/h4-5,7,10,12-13,17,21,23-24H,1-3,6,8-9,11,14-16,18H2/t23-,24+/m1/s1 |
| InChIKey | IKAFQONNWBCPOP-RPWUZVMVSA-N |
| XLogP | 5.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |