C23H25N3O2 — CID 119061772
N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(2-hydroxyphenyl)-N-methylbenzamide (PubChem CID 119061772) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(2-hydroxyphenyl)-N-methylbenzamide.
| Compound Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(2-hydroxyphenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 119061772 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-3-(2-hydroxyphenyl)-N-methylbenzamide |
| SMILES | CN(Cc1n[nH]c2c1CCCCC2)C(=O)c1cccc(-c2ccccc2O)c1 |
| InChI | InChI=1S/C23H25N3O2/c1-26(15-21-19-11-3-2-4-12-20(19)24-25-21)23(28)17-9-7-8-16(14-17)18-10-5-6-13-22(18)27/h5-10,13-14,27H,2-4,11-12,15H2,1H3,(H,24,25) |
| InChIKey | RNLGBSSSSNXDAW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |