C19H28ClNO3 — CID 119062522
2-[[(3aR,6S,7aS)-1-[(4-chloro-2-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]oxy]ethanol (PubChem CID 119062522) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is 2-[[(3aR,6S,7aS)-1-[(4-chloro-2-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]oxy]ethanol.
| Compound Name | 2-[[(3aR,6S,7aS)-1-[(4-chloro-2-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]oxy]ethanol |
|---|---|
| PubChem CID | 119062522 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-[[(3aR,6S,7aS)-1-[(4-chloro-2-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]oxy]ethanol |
| SMILES | CO[C@@]12CC[C@H](OCCO)C[C@@H]1N(Cc1ccc(Cl)cc1C)CC2 |
| InChI | InChI=1S/C19H28ClNO3/c1-14-11-16(20)4-3-15(14)13-21-8-7-19(23-2)6-5-17(12-18(19)21)24-10-9-22/h3-4,11,17-18,22H,5-10,12-13H2,1-2H3/t17-,18-,19+/m0/s1 |
| InChIKey | MOWUZTSTAQBMOC-GBESFXJTSA-N |
| XLogP | 3.17 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |