C17H18N2O4 — CID 119063541
N-[(2S,3R)-3-hydroxy-1-oxo-1-(prop-2-ynylamino)butan-2-yl]-5-methyl-1-benzofuran-2-carboxamide (PubChem CID 119063541) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-oxo-1-(prop-2-ynylamino)butan-2-yl]-5-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-oxo-1-(prop-2-ynylamino)butan-2-yl]-5-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 119063541 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-oxo-1-(prop-2-ynylamino)butan-2-yl]-5-methyl-1-benzofuran-2-carboxamide |
| SMILES | C#CCNC(=O)[C@@H](NC(=O)c1cc2cc(C)ccc2o1)[C@@H](C)O |
| InChI | InChI=1S/C17H18N2O4/c1-4-7-18-17(22)15(11(3)20)19-16(21)14-9-12-8-10(2)5-6-13(12)23-14/h1,5-6,8-9,11,15,20H,7H2,2-3H3,(H,18,22)(H,19,21)/t11-,15+/m1/s1 |
| InChIKey | NTYRVTJEJROLHG-ABAIWWIYSA-N |
| XLogP | 0.97 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|