C19H27NO3 — CID 119063914
(3aR,6R,7aS)-3a-methoxy-1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol (PubChem CID 119063914) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (3aR,6R,7aS)-3a-methoxy-1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol.
| Compound Name | (3aR,6R,7aS)-3a-methoxy-1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 119063914 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3aR,6R,7aS)-3a-methoxy-1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
| SMILES | COc1ccc(/C=C/CN2CC[C@]3(OC)CC[C@@H](O)C[C@H]23)cc1 |
| InChI | InChI=1S/C19H27NO3/c1-22-17-7-5-15(6-8-17)4-3-12-20-13-11-19(23-2)10-9-16(21)14-18(19)20/h3-8,16,18,21H,9-14H2,1-2H3/b4-3+/t16-,18+,19-/m1/s1 |
| InChIKey | XSERNBSBADJXER-IDCBKMMBSA-N |
| XLogP | 2.71 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |