C17H23N5O — CID 119064146
(7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone (PubChem CID 119064146) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is (7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone.
| Compound Name | (7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
|---|---|
| PubChem CID | 119064146 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (7-methyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methanone |
| SMILES | Cc1ccn2c(C(=O)N3C[C@]4(C)C[C@H]3CC(C)(C)C4)nnc2n1 |
| InChI | InChI=1S/C17H23N5O/c1-11-5-6-21-13(19-20-15(21)18-11)14(23)22-10-17(4)8-12(22)7-16(2,3)9-17/h5-6,12H,7-10H2,1-4H3/t12-,17-/m1/s1 |
| InChIKey | DCSFDBADKZGASC-SJKOYZFVSA-N |
| XLogP | 2.47 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |