C20H23NO2S — CID 119064304
(3-methoxypiperidin-1-yl)-[4-(2-methylsulfanylphenyl)phenyl]methanone (PubChem CID 119064304) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is (3-methoxypiperidin-1-yl)-[4-(2-methylsulfanylphenyl)phenyl]methanone.
| Compound Name | (3-methoxypiperidin-1-yl)-[4-(2-methylsulfanylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 119064304 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3-methoxypiperidin-1-yl)-[4-(2-methylsulfanylphenyl)phenyl]methanone |
| SMILES | COC1CCCN(C(=O)c2ccc(-c3ccccc3SC)cc2)C1 |
| InChI | InChI=1S/C20H23NO2S/c1-23-17-6-5-13-21(14-17)20(22)16-11-9-15(10-12-16)18-7-3-4-8-19(18)24-2/h3-4,7-12,17H,5-6,13-14H2,1-2H3 |
| InChIKey | KHNRVNBAANSUDO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |