C20H27F2NO2 — CID 119066647
(3aR,6R,7aS)-6-(cyclopropylmethoxy)-1-[(2,4-difluorophenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119066647) has the molecular formula C20H27F2NO2 and a molecular weight of 351.44 g/mol. Its IUPAC name is (3aR,6R,7aS)-6-(cyclopropylmethoxy)-1-[(2,4-difluorophenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6R,7aS)-6-(cyclopropylmethoxy)-1-[(2,4-difluorophenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119066647 |
| Molecular Formula | C20H27F2NO2 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (3aR,6R,7aS)-6-(cyclopropylmethoxy)-1-[(2,4-difluorophenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CO[C@@]12CC[C@@H](OCC3CC3)C[C@@H]1N(Cc1ccc(F)cc1F)CC2 |
| InChI | InChI=1S/C20H27F2NO2/c1-24-20-7-6-17(25-13-14-2-3-14)11-19(20)23(9-8-20)12-15-4-5-16(21)10-18(15)22/h4-5,10,14,17,19H,2-3,6-9,11-13H2,1H3/t17-,19+,20-/m1/s1 |
| InChIKey | ADWPMMFWMCXQDI-YZGWKJHDSA-N |
| XLogP | 3.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |