C17H23N3O4S — CID 119066691
1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-pyrimidin-2-ylsulfanylethanone (PubChem CID 119066691) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-pyrimidin-2-ylsulfanylethanone.
| Compound Name | 1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-pyrimidin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 119066691 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[(1S,2S,7S,10S)-1-hydroxy-4,12-dioxa-8-azatricyclo[8.4.0.02,7]tetradecan-8-yl]-2-pyrimidin-2-ylsulfanylethanone |
| SMILES | O=C(CSc1ncccn1)N1C[C@H]2COCC[C@@]2(O)[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C17H23N3O4S/c21-15(11-25-16-18-4-1-5-19-16)20-8-12-9-24-7-3-17(12,22)13-10-23-6-2-14(13)20/h1,4-5,12-14,22H,2-3,6-11H2/t12-,13+,14-,17-/m0/s1 |
| InChIKey | UUYPRLUHAMRHAC-LOUJCGABSA-N |
| XLogP | 0.58 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |