About N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide
N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide (PubChem CID 119067898) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide.
Molecular Properties
| Compound Name | N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide |
| PubChem CID | 119067898 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)NCc1cnc2cnccn12 |
| InChI | InChI=1S/C14H20N4O/c1-14(2,3)5-4-13(19)17-9-11-8-16-12-10-15-6-7-18(11)12/h6-8,10H,4-5,9H2,1-3H3,(H,17,19) |
| InChIKey | GNBMBSWSGHLDCJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide?
The IUPAC name of N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide (CID 119067898) is N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide.
What is the SMILES notation for N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide?
The canonical SMILES for N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide is CC(C)(C)CCC(=O)NCc1cnc2cnccn12.
What is the InChIKey of N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide?
The InChIKey is GNBMBSWSGHLDCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O/c1-14(2,3)5-4-13(19)17-9-11-8-16-12-10-15-6-7-18(11)12/h6-8,10H,4-5,9H2,1-3H3,(H,17,19).
What are the key properties of N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide?
N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide has a molecular weight of 260.34 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(imidazo[1,2-a]pyrazin-3-ylmethyl)-4,4-dimethylpentanamide is sourced from PubChem (CID 119067898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).