C21H25NO3 — CID 119068135
[3-[4-(1-hydroxyethyl)phenyl]phenyl]-[4-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 119068135) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is [3-[4-(1-hydroxyethyl)phenyl]phenyl]-[4-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | [3-[4-(1-hydroxyethyl)phenyl]phenyl]-[4-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119068135 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [3-[4-(1-hydroxyethyl)phenyl]phenyl]-[4-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | CC(O)c1ccc(-c2cccc(C(=O)N3CCC(CO)CC3)c2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-15(24)17-5-7-18(8-6-17)19-3-2-4-20(13-19)21(25)22-11-9-16(14-23)10-12-22/h2-8,13,15-16,23-24H,9-12,14H2,1H3 |
| InChIKey | VOLCACXKNSQFOP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |