About 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide
5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide (PubChem CID 119068358) has the molecular formula C18H15FN4O3
and a molecular weight of 354.34 g/mol. Its IUPAC name is 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide |
| PubChem CID | 119068358 |
| Molecular Formula | C18H15FN4O3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)N(Cc2cocn2)Cc2cocn2)cc2cc(F)ccc21 |
| InChI | InChI=1S/C18H15FN4O3/c1-22-16-3-2-13(19)4-12(16)5-17(22)18(24)23(6-14-8-25-10-20-14)7-15-9-26-11-21-15/h2-5,8-11H,6-7H2,1H3 |
| InChIKey | MZZLRKGSGXVDFN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide?
The IUPAC name of 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide (CID 119068358) is 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide.
What is the SMILES notation for 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide?
The canonical SMILES for 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide is Cn1c(C(=O)N(Cc2cocn2)Cc2cocn2)cc2cc(F)ccc21.
What is the InChIKey of 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide?
The InChIKey is MZZLRKGSGXVDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN4O3/c1-22-16-3-2-13(19)4-12(16)5-17(22)18(24)23(6-14-8-25-10-20-14)7-15-9-26-11-21-15/h2-5,8-11H,6-7H2,1H3.
What are the key properties of 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide?
5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide has a molecular weight of 354.34 g/mol, XLogP of 3.14, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-methyl-N,N-bis(1,3-oxazol-4-ylmethyl)indole-2-carboxamide is sourced from PubChem (CID 119068358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).