C20H28N6O — CID 119068865
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-(4-imidazo[1,2-b]pyridazin-6-ylpiperazin-1-yl)methanone (PubChem CID 119068865) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-(4-imidazo[1,2-b]pyridazin-6-ylpiperazin-1-yl)methanone.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-(4-imidazo[1,2-b]pyridazin-6-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 119068865 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-(4-imidazo[1,2-b]pyridazin-6-ylpiperazin-1-yl)methanone |
| SMILES | O=C([C@@H]1CCCN2CCCC[C@H]12)N1CCN(c2ccc3nccn3n2)CC1 |
| InChI | InChI=1S/C20H28N6O/c27-20(16-4-3-10-23-9-2-1-5-17(16)23)25-14-12-24(13-15-25)19-7-6-18-21-8-11-26(18)22-19/h6-8,11,16-17H,1-5,9-10,12-15H2/t16-,17-/m1/s1 |
| InChIKey | HKCYCIJWPOZNGT-IAGOWNOFSA-N |
| XLogP | 1.64 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |