C17H24N2O3 — CID 119069520
[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-methyl-2-pyridinyl)methanone (PubChem CID 119069520) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-methyl-2-pyridinyl)methanone.
| Compound Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-methyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 119069520 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(3-methyl-2-pyridinyl)methanone |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(C(=O)c3ncccc3C)[C@H]2C1 |
| InChI | InChI=1S/C17H24N2O3/c1-12-5-4-9-18-15(12)16(20)19-10-8-17(22-3)7-6-13(21-2)11-14(17)19/h4-5,9,13-14H,6-8,10-11H2,1-3H3/t13-,14-,17+/m0/s1 |
| InChIKey | MLTMDLIXGIBXLT-GRDNDAEWSA-N |
| XLogP | 2.19 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |