About N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide
N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide (PubChem CID 119069644) has the molecular formula C17H13N5O3S
and a molecular weight of 367.39 g/mol. Its IUPAC name is N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide |
| PubChem CID | 119069644 |
| Molecular Formula | C17H13N5O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide |
| SMILES | O=C(c1cnc(-c2cccs2)nc1)N(Cc1cocn1)Cc1cocn1 |
| InChI | InChI=1S/C17H13N5O3S/c23-17(12-4-18-16(19-5-12)15-2-1-3-26-15)22(6-13-8-24-10-20-13)7-14-9-25-11-21-14/h1-5,8-11H,6-7H2 |
| InChIKey | OVZJJOBHTISNSA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide?
The IUPAC name of N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide (CID 119069644) is N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide.
What is the SMILES notation for N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide?
The canonical SMILES for N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide is O=C(c1cnc(-c2cccs2)nc1)N(Cc1cocn1)Cc1cocn1.
What is the InChIKey of N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide?
The InChIKey is OVZJJOBHTISNSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5O3S/c23-17(12-4-18-16(19-5-12)15-2-1-3-26-15)22(6-13-8-24-10-20-13)7-14-9-25-11-21-14/h1-5,8-11H,6-7H2.
What are the key properties of N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide?
N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide has a molecular weight of 367.39 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(1,3-oxazol-4-ylmethyl)-2-thiophen-2-ylpyrimidine-5-carboxamide is sourced from PubChem (CID 119069644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).