C19H25N3O2S — CID 119070185
(3aR,6R,7aS)-3a,6-dimethoxy-1-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119070185) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is (3aR,6R,7aS)-3a,6-dimethoxy-1-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119070185 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3aR,6R,7aS)-3a,6-dimethoxy-1-[(2-thiophen-2-ylpyrimidin-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(Cc3cnc(-c4cccs4)nc3)[C@H]2C1 |
| InChI | InChI=1S/C19H25N3O2S/c1-23-15-5-6-19(24-2)7-8-22(17(19)10-15)13-14-11-20-18(21-12-14)16-4-3-9-25-16/h3-4,9,11-12,15,17H,5-8,10,13H2,1-2H3/t15-,17+,19-/m1/s1 |
| InChIKey | NHEAUHVZOHKMFH-HHXXYDBFSA-N |
| XLogP | 3.36 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |