About 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide
4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide (PubChem CID 119070958) has the molecular formula C13H18ClN3O3
and a molecular weight of 299.76 g/mol. Its IUPAC name is 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 119070958 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(N[C@H]1COC[C@@H]1N1CCOCC1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C13H18ClN3O3/c14-9-5-10(15-6-9)13(18)16-11-7-20-8-12(11)17-1-3-19-4-2-17/h5-6,11-12,15H,1-4,7-8H2,(H,16,18)/t11-,12-/m0/s1 |
| InChIKey | LZOLJVNZKVXRCV-RYUDHWBXSA-N |
| XLogP | 0.50 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide (CID 119070958) is 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide is O=C(N[C@H]1COC[C@@H]1N1CCOCC1)c1cc(Cl)c[nH]1.
What is the InChIKey of 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide?
The InChIKey is LZOLJVNZKVXRCV-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H18ClN3O3/c14-9-5-10(15-6-9)13(18)16-11-7-20-8-12(11)17-1-3-19-4-2-17/h5-6,11-12,15H,1-4,7-8H2,(H,16,18)/t11-,12-/m0/s1.
What are the key properties of 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide?
4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide has a molecular weight of 299.76 g/mol, XLogP of 0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3R,4R)-4-morpholin-4-yloxolan-3-yl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 119070958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).