C22H26N2OS — CID 119071128
[4-(4-methylsulfanylphenyl)phenyl]-(3-piperidin-1-ylazetidin-1-yl)methanone (PubChem CID 119071128) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is [4-(4-methylsulfanylphenyl)phenyl]-(3-piperidin-1-ylazetidin-1-yl)methanone.
| Compound Name | [4-(4-methylsulfanylphenyl)phenyl]-(3-piperidin-1-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 119071128 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [4-(4-methylsulfanylphenyl)phenyl]-(3-piperidin-1-ylazetidin-1-yl)methanone |
| SMILES | CSc1ccc(-c2ccc(C(=O)N3CC(N4CCCCC4)C3)cc2)cc1 |
| InChI | InChI=1S/C22H26N2OS/c1-26-21-11-9-18(10-12-21)17-5-7-19(8-6-17)22(25)24-15-20(16-24)23-13-3-2-4-14-23/h5-12,20H,2-4,13-16H2,1H3 |
| InChIKey | RCQAQLRRUNFUJE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |