C16H22FN3O3 — CID 119071247
N-(3-amino-3-oxopropyl)-3-[(2-fluorophenoxy)methyl]piperidine-1-carboxamide (PubChem CID 119071247) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-3-[(2-fluorophenoxy)methyl]piperidine-1-carboxamide.
| Compound Name | N-(3-amino-3-oxopropyl)-3-[(2-fluorophenoxy)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119071247 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-3-[(2-fluorophenoxy)methyl]piperidine-1-carboxamide |
| SMILES | NC(=O)CCNC(=O)N1CCCC(COc2ccccc2F)C1 |
| InChI | InChI=1S/C16H22FN3O3/c17-13-5-1-2-6-14(13)23-11-12-4-3-9-20(10-12)16(22)19-8-7-15(18)21/h1-2,5-6,12H,3-4,7-11H2,(H2,18,21)(H,19,22) |
| InChIKey | BXMUBVPAQHBGCP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |