C19H21FN2O3 — CID 119072779
4-[(2-fluoro-5-methoxyphenyl)methyl]-1-(2-methoxyphenyl)piperazin-2-one (PubChem CID 119072779) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-[(2-fluoro-5-methoxyphenyl)methyl]-1-(2-methoxyphenyl)piperazin-2-one.
| Compound Name | 4-[(2-fluoro-5-methoxyphenyl)methyl]-1-(2-methoxyphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 119072779 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[(2-fluoro-5-methoxyphenyl)methyl]-1-(2-methoxyphenyl)piperazin-2-one |
| SMILES | COc1ccc(F)c(CN2CCN(c3ccccc3OC)C(=O)C2)c1 |
| InChI | InChI=1S/C19H21FN2O3/c1-24-15-7-8-16(20)14(11-15)12-21-9-10-22(19(23)13-21)17-5-3-4-6-18(17)25-2/h3-8,11H,9-10,12-13H2,1-2H3 |
| InChIKey | PXAZIDQSOUBVAD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |