C22H28N4O — CID 119073848
(4-cyclohexyl-1,4-diazepan-1-yl)-(4-pyrazin-2-ylphenyl)methanone (PubChem CID 119073848) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (4-cyclohexyl-1,4-diazepan-1-yl)-(4-pyrazin-2-ylphenyl)methanone.
| Compound Name | (4-cyclohexyl-1,4-diazepan-1-yl)-(4-pyrazin-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 119073848 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (4-cyclohexyl-1,4-diazepan-1-yl)-(4-pyrazin-2-ylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cnccn2)cc1)N1CCCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H28N4O/c27-22(19-9-7-18(8-10-19)21-17-23-11-12-24-21)26-14-4-13-25(15-16-26)20-5-2-1-3-6-20/h7-12,17,20H,1-6,13-16H2 |
| InChIKey | SPINFGDZRQEFKT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |