C26H23N3O4S — CID 1190743
(2R)-2-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-4-one (PubChem CID 1190743) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is (2R)-2-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2R)-2-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1190743 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (2R)-2-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS[C@H](c2cn(-c3ccccc3)nc2-c2cc3ccccc3oc2=O)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C26H23N3O4S/c30-23-16-34-25(28(23)14-19-10-6-12-32-19)21-15-29(18-8-2-1-3-9-18)27-24(21)20-13-17-7-4-5-11-22(17)33-26(20)31/h1-5,7-9,11,13,15,19,25H,6,10,12,14,16H2/t19-,25+/m0/s1 |
| InChIKey | XWOAKFYVXMTWJJ-UQBPGWFLSA-N |
| XLogP | 4.40 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|