C20H38N2O2 — CID 11907466
ethyl (1R,4S,6R)-4-[3-(dimethylamino)propylamino]-2-methyl-6-pentylcyclohex-2-ene-1-carboxylate (PubChem CID 11907466) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is ethyl (1R,4S,6R)-4-[3-(dimethylamino)propylamino]-2-methyl-6-pentylcyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl (1R,4S,6R)-4-[3-(dimethylamino)propylamino]-2-methyl-6-pentylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 11907466 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | ethyl (1R,4S,6R)-4-[3-(dimethylamino)propylamino]-2-methyl-6-pentylcyclohex-2-ene-1-carboxylate |
| SMILES | CCCCC[C@@H]1C[C@H](NCCCN(C)C)C=C(C)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C20H38N2O2/c1-6-8-9-11-17-15-18(21-12-10-13-22(4)5)14-16(3)19(17)20(23)24-7-2/h14,17-19,21H,6-13,15H2,1-5H3/t17-,18-,19+/m1/s1 |
| InChIKey | JRFXBJKUUCWENF-QRVBRYPASA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|