C17H22N4OS — CID 119074661
4-[6-(dimethylamino)pyrimidin-4-yl]-N-(2-ethylsulfanylethyl)benzamide (PubChem CID 119074661) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 4-[6-(dimethylamino)pyrimidin-4-yl]-N-(2-ethylsulfanylethyl)benzamide.
| Compound Name | 4-[6-(dimethylamino)pyrimidin-4-yl]-N-(2-ethylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 119074661 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-[6-(dimethylamino)pyrimidin-4-yl]-N-(2-ethylsulfanylethyl)benzamide |
| SMILES | CCSCCNC(=O)c1ccc(-c2cc(N(C)C)ncn2)cc1 |
| InChI | InChI=1S/C17H22N4OS/c1-4-23-10-9-18-17(22)14-7-5-13(6-8-14)15-11-16(21(2)3)20-12-19-15/h5-8,11-12H,4,9-10H2,1-3H3,(H,18,22) |
| InChIKey | YIDXILNIICGHLK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|