About CID 119077121
CID 119077121 (PubChem CID 119077121) has the molecular formula C15H17NOSi
and a molecular weight of 255.39 g/mol.
Molecular Properties
| Compound Name | CID 119077121 |
| PubChem CID | 119077121 |
| Molecular Formula | C15H17NOSi |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | — |
| SMILES | COc1ccc(N(C)C)cc1[Si]c1ccccc1 |
| InChI | InChI=1S/C15H17NOSi/c1-16(2)12-9-10-14(17-3)15(11-12)18-13-7-5-4-6-8-13/h4-11H,1-3H3 |
| InChIKey | ACSZNKOUNQZRTD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 119077121 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119077121?
The IUPAC name of CID 119077121 (CID 119077121) is not available.
What is the SMILES notation for CID 119077121?
The canonical SMILES for CID 119077121 is COc1ccc(N(C)C)cc1[Si]c1ccccc1.
What is the InChIKey of CID 119077121?
The InChIKey is ACSZNKOUNQZRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NOSi/c1-16(2)12-9-10-14(17-3)15(11-12)18-13-7-5-4-6-8-13/h4-11H,1-3H3.
What are the key properties of CID 119077121?
CID 119077121 has a molecular weight of 255.39 g/mol, XLogP of 1.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119077121 is sourced from PubChem (CID 119077121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).