About CID 119077292
CID 119077292 (PubChem CID 119077292) has the molecular formula C23H18GeO
and a molecular weight of 383.01 g/mol.
Molecular Properties
| Compound Name | CID 119077292 |
| PubChem CID | 119077292 |
| Molecular Formula | C23H18GeO |
| Molecular Weight | 383.01 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | — |
| SMILES | C1=CC2[Ge]O[C@H]([C@H]3C[C@@H]3c3ccccc3)C3=C2C(=C1)c1ccccc13 |
| InChI | InChI=1S/C23H18GeO/c1-2-7-14(8-3-1)18-13-19(18)23-22-17-10-5-4-9-15(17)16-11-6-12-20(21(16)22)24-25-23/h1-12,18-20,23H,13H2/t18-,19+,20?,23-/m1/s1 |
| InChIKey | KMESIUJOQBLYGH-QNLWVQNGSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.01 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 119077292 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119077292?
The IUPAC name of CID 119077292 (CID 119077292) is not available.
What is the SMILES notation for CID 119077292?
The canonical SMILES for CID 119077292 is C1=CC2[Ge]O[C@H]([C@H]3C[C@@H]3c3ccccc3)C3=C2C(=C1)c1ccccc13.
What is the InChIKey of CID 119077292?
The InChIKey is KMESIUJOQBLYGH-QNLWVQNGSA-N. The full InChI is InChI=1S/C23H18GeO/c1-2-7-14(8-3-1)18-13-19(18)23-22-17-10-5-4-9-15(17)16-11-6-12-20(21(16)22)24-25-23/h1-12,18-20,23H,13H2/t18-,19+,20?,23-/m1/s1.
What are the key properties of CID 119077292?
CID 119077292 has a molecular weight of 383.01 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119077292 is sourced from PubChem (CID 119077292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).