C26H39N2+ — CID 119077687
(6Z,19Z)-14-aza-1-azoniatricyclo[21.3.1.110,14]octacosa-1(27),6,10(28),11,19,23-hexaene (PubChem CID 119077687) has the molecular formula C26H39N2+ and a molecular weight of 379.61 g/mol. Its IUPAC name is (6Z,19Z)-14-aza-1-azoniatricyclo[21.3.1.110,14]octacosa-1(27),6,10(28),11,19,23-hexaene.
| Compound Name | (6Z,19Z)-14-aza-1-azoniatricyclo[21.3.1.110,14]octacosa-1(27),6,10(28),11,19,23-hexaene |
|---|---|
| PubChem CID | 119077687 |
| Molecular Formula | C26H39N2+ |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | (6Z,19Z)-14-aza-1-azoniatricyclo[21.3.1.110,14]octacosa-1(27),6,10(28),11,19,23-hexaene |
| SMILES | C1=CC2=CN(C1)CCCC/C=C\CCC1=CCC[N+](=C1)CCCC/C=C\CC2 |
| InChI | InChI=1S/C26H39N2/c1-3-7-11-19-27-21-14-18-26(24-27)16-10-6-2-4-8-12-20-28-22-13-17-25(23-28)15-9-5-1/h1-2,5-6,13,17-18,23-24H,3-4,7-12,14-16,19-22H2/q+1/b5-1-,6-2- |
| InChIKey | CHNJYFWNPTZPTF-IOBHVTPZSA-N |
| XLogP | 6.18 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|