C19H24FN4O3+ — CID 11907797
[(1S,2S)-2-[[(5S)-1-[2-(4-fluorophenyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium (PubChem CID 11907797) has the molecular formula C19H24FN4O3+ and a molecular weight of 375.42 g/mol. Its IUPAC name is [(1S,2S)-2-[[(5S)-1-[2-(4-fluorophenyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium.
| Compound Name | [(1S,2S)-2-[[(5S)-1-[2-(4-fluorophenyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium |
|---|---|
| PubChem CID | 11907797 |
| Molecular Formula | C19H24FN4O3+ |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(1S,2S)-2-[[(5S)-1-[2-(4-fluorophenyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]cyclohexyl]azanium |
| SMILES | [NH3+][C@H]1CCCC[C@@H]1/N=C/[C@H]1C(=O)NC(=O)N(CCc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H23FN4O3/c20-13-7-5-12(6-8-13)9-10-24-18(26)14(17(25)23-19(24)27)11-22-16-4-2-1-3-15(16)21/h5-8,11,14-16H,1-4,9-10,21H2,(H,23,25,27)/p+1/b22-11+/t14-,15-,16-/m0/s1 |
| InChIKey | BPGMHWBPDAXFOF-ONAMVWNYSA-O |
| XLogP | 0.69 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|