C17H26N2O4 — CID 11907804
[(2R)-1-[[(1S,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 11907804) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3,5-dimethyl-1,2-oxazole-4-carboxylate.
| Compound Name | [(2R)-1-[[(1S,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11907804 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [(2R)-1-[[(1S,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1noc(C)c1C(=O)O[C@H](C)C(=O)N[C@H]1CCC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C17H26N2O4/c1-9-7-6-8-14(10(9)2)18-16(20)13(5)22-17(21)15-11(3)19-23-12(15)4/h9-10,13-14H,6-8H2,1-5H3,(H,18,20)/t9-,10-,13+,14-/m0/s1 |
| InChIKey | GYEVRYWMUZHXBV-ZNIXKSQXSA-N |
| XLogP | 2.78 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |