About CID 119078061
CID 119078061 (PubChem CID 119078061) has the molecular formula C28H52BN2P2
and a molecular weight of 489.50 g/mol.
Molecular Properties
| Compound Name | CID 119078061 |
| PubChem CID | 119078061 |
| Molecular Formula | C28H52BN2P2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.37 |
| IUPAC Name | — |
| SMILES | CC(C)(C)P(CCCN1[B]N(CCCP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C28H52BN2P2/c1-25(2,3)32(26(4,5)6)21-15-19-30-23-17-13-14-18-24(23)31(29-30)20-16-22-33(27(7,8)9)28(10,11)12/h13-14,17-18H,15-16,19-22H2,1-12H3 |
| InChIKey | WZKBTDFPWNQNRB-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 119078061 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119078061?
The IUPAC name of CID 119078061 (CID 119078061) is not available.
What is the SMILES notation for CID 119078061?
The canonical SMILES for CID 119078061 is CC(C)(C)P(CCCN1[B]N(CCCP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C.
What is the InChIKey of CID 119078061?
The InChIKey is WZKBTDFPWNQNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H52BN2P2/c1-25(2,3)32(26(4,5)6)21-15-19-30-23-17-13-14-18-24(23)31(29-30)20-16-22-33(27(7,8)9)28(10,11)12/h13-14,17-18H,15-16,19-22H2,1-12H3.
What are the key properties of CID 119078061?
CID 119078061 has a molecular weight of 489.50 g/mol, XLogP of 8.79, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119078061 is sourced from PubChem (CID 119078061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).