C21H25NO5 — CID 11907852
[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 11907852) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11907852 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)COC(=O)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C21H25NO5/c1-12-6-5-9-17(13(12)2)22-19(24)11-27-21(26)16-10-18(23)14-7-3-4-8-15(14)20(16)25/h3-4,7-8,10,12-13,17,23,25H,5-6,9,11H2,1-2H3,(H,22,24)/t12-,13+,17+/m0/s1 |
| InChIKey | LNTKMWLBVKAPLZ-OGHNNQOOSA-N |
| XLogP | 3.35 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|