C21H28ClN4O3+ — CID 11907854
(4aR)-7-chloro-1',3,3'-triethylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 11907854) has the molecular formula C21H28ClN4O3+ and a molecular weight of 419.93 g/mol. Its IUPAC name is (4aR)-7-chloro-1',3,3'-triethylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aR)-7-chloro-1',3,3'-triethylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 11907854 |
| Molecular Formula | C21H28ClN4O3+ |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (4aR)-7-chloro-1',3,3'-triethylspiro[1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinolin-3-ium-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | CCN1C(=O)N(CC)C(=O)C2(Cc3c(Cl)cccc3N3CC[NH+](CC)C[C@H]32)C1=O |
| InChI | InChI=1S/C21H27ClN4O3/c1-4-23-10-11-26-16-9-7-8-15(22)14(16)12-21(17(26)13-23)18(27)24(5-2)20(29)25(6-3)19(21)28/h7-9,17H,4-6,10-13H2,1-3H3/p+1/t17-/m0/s1 |
| InChIKey | ORULVQPKGJSAEF-KRWDZBQOSA-O |
| XLogP | 0.81 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|