C20H23ClN3O3+ — CID 11907889
2-[(1R,2R,6R,7R,8R,12S)-5-(4-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]ethyl-dimethylazanium (PubChem CID 11907889) has the molecular formula C20H23ClN3O3+ and a molecular weight of 388.88 g/mol. Its IUPAC name is 2-[(1R,2R,6R,7R,8R,12S)-5-(4-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]ethyl-dimethylazanium.
| Compound Name | 2-[(1R,2R,6R,7R,8R,12S)-5-(4-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 11907889 |
| Molecular Formula | C20H23ClN3O3+ |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[(1R,2R,6R,7R,8R,12S)-5-(4-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCN1C(=O)[C@@H]2[C@@H]3C[C@@H]([C@H]4ON=C(c5ccc(Cl)cc5)[C@@H]34)[C@@H]2C1=O |
| InChI | InChI=1S/C20H22ClN3O3/c1-23(2)7-8-24-19(25)14-12-9-13(15(14)20(24)26)18-16(12)17(22-27-18)10-3-5-11(21)6-4-10/h3-6,12-16,18H,7-9H2,1-2H3/p+1/t12-,13+,14+,15-,16+,18+/m0/s1 |
| InChIKey | HSVBWPQKJKLSAT-PTENTFFRSA-O |
| XLogP | 0.45 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|